CAS 54625-53-5 is the registry number for 1-Chloro-2,3,4-trimethoxybenzene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-chloro-2,3,4-trimethoxybenzene (CAS 54625-53-5) is a chemical compound with the molecular formula C9H11ClO3 and a molecular weight of 202.63 g/mol. IUPAC name: 1-chloro-2,3,4-trimethoxybenzene. InChIKey: LIHWMLGRCUKVLB-UHFFFAOYSA-N.
| Molecular formula | C9H11ClO3 |
|---|---|
| Molecular weight | 202.63 g/mol |
| IUPAC name | 1-chloro-2,3,4-trimethoxybenzene |
| InChIKey | LIHWMLGRCUKVLB-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)Cl)OC)OC |
Computed by PubChem (NCBI)