CAS 140665-34-5 appears in our catalog under these names: 2-chloro-1,3,4-trimethoxybenzene, 95%, 2-Chloro-1,3,4-trimethoxybenzene, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg.
2-chloro-1,3,4-trimethoxybenzene (CAS 140665-34-5) is a chemical compound with the molecular formula C9H11ClO3 and a molecular weight of 202.63 g/mol. IUPAC name: 2-chloro-1,3,4-trimethoxybenzene. InChIKey: LAKKTEWECMKSJS-UHFFFAOYSA-N.
| Molecular formula | C9H11ClO3 |
|---|---|
| Molecular weight | 202.63 g/mol |
| IUPAC name | 2-chloro-1,3,4-trimethoxybenzene |
| InChIKey | LAKKTEWECMKSJS-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)OC)Cl)OC |
Computed by PubChem (NCBI)