2-Chloro-1,5-naphthyridine, 97%
cas: 7689-62-5 — see every product listed under this CAS number, including other names
2-Chloro-1,5-naphthyridine, 97% (CAS 7689-62-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g, 100mg. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A168951-250mg |
| cas | 7689-62-5 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 292.50 Pln | |
| Ambeed | 1g | 520.56 Pln | |
| Ambeed | 5g | 1583.00 Pln | |
| Ambeed | 25g | 6589.25 Pln | |
| Ambeed | 100g | 24200.12 Pln | |
| BLDpharm | 100mg | 264.38 Pln | |
| BLDpharm | 250mg | 308.80 Pln | |
| BLDpharm | 1g | 553.16 Pln | |
| BLDpharm | 5g | 1702.76 Pln | |
| BLDpharm | 25g | 7100.86 Pln | |
| BLDpharm | 100g | 26088.62 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
2-chloro-1,5-naphthyridine (CAS 7689-62-5) is a chemical compound with the molecular formula C8H5ClN2 and a molecular weight of 164.59 g/mol. IUPAC name: 2-chloro-1,5-naphthyridine. InChIKey: JUYRQGHDOBBUEA-UHFFFAOYSA-N.
| Molecular formula | C8H5ClN2 |
|---|---|
| Molecular weight | 164.59 g/mol |
| IUPAC name | 2-chloro-1,5-naphthyridine |
| InChIKey | JUYRQGHDOBBUEA-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=N2)Cl)N=C1 |
Computed by PubChem (NCBI)
Synonyms:
1,5-Naphthyridine, 2-chloro-