CAS 2096443-31-9 is the registry number for 3-(2-Chloropyridin-3-yl)prop-2-enenitrile, E/Z mixture, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(E)-3-(2-chloro-3-pyridinyl)prop-2-enenitrile (CAS 2096443-31-9) is a chemical compound with the molecular formula C8H5ClN2 and a molecular weight of 164.59 g/mol. IUPAC name: (E)-3-(2-chloro-3-pyridinyl)prop-2-enenitrile. InChIKey: ZVRPQUCIVQDKCW-HNQUOIGGSA-N.
| Molecular formula | C8H5ClN2 |
|---|---|
| Molecular weight | 164.59 g/mol |
| IUPAC name | (E)-3-(2-chloro-3-pyridinyl)prop-2-enenitrile |
| InChIKey | ZVRPQUCIVQDKCW-HNQUOIGGSA-N |
| SMILES | C1=CC(=C(N=C1)Cl)/C=C/C#N |
Computed by PubChem (NCBI)