CAS 5152-84-1 appears in our catalog under these names: 4-Chloro-cinnoline, 95%, 4-Chlorocinnoline, 4-Chlorocinnoline 97%, 4-Chlorocinnoline, 97%, 97%, 4-Chlorocinnoline, 95%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 10g, 5g, 250mg, 0,5g, 100mg.
4-chlorocinnoline (CAS 5152-84-1) is a chemical compound with the molecular formula C8H5ClN2 and a molecular weight of 164.59 g/mol. IUPAC name: 4-chlorocinnoline. InChIKey: IJSFFUOWXQRDMS-UHFFFAOYSA-N.
| Molecular formula | C8H5ClN2 |
|---|---|
| Molecular weight | 164.59 g/mol |
| IUPAC name | 4-chlorocinnoline |
| InChIKey | IJSFFUOWXQRDMS-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN=N2)Cl |
Computed by PubChem (NCBI)