CAS 13058-77-0 appears in our catalog under these names: 8-Chloro-1,7-naphthyridine, 97%, 8-Chloro-1,7-naphthyridine 95%, 8-Chloro-1,7-naphthyridine, 97%, 97%, 8-Chloro-1,7-naphthyridine, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg.
8-chloro-1,7-naphthyridine (CAS 13058-77-0) is a chemical compound with the molecular formula C8H5ClN2 and a molecular weight of 164.59 g/mol. IUPAC name: 8-chloro-1,7-naphthyridine. InChIKey: FMSVBSQYYFTDSR-UHFFFAOYSA-N.
| Molecular formula | C8H5ClN2 |
|---|---|
| Molecular weight | 164.59 g/mol |
| IUPAC name | 8-chloro-1,7-naphthyridine |
| InChIKey | FMSVBSQYYFTDSR-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=NC=C2)Cl)N=C1 |
Computed by PubChem (NCBI)