cas: 150444-93-2 — see every product listed under this CAS number, including other names
2-Chloro-3,4-difluorobenzoic acid 95% (CAS 150444-93-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A108677-100mg |
| cas | 150444-93-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 197.94 Pln | |
| Ambeed | 1g | 353.69 Pln | |
| Ambeed | 5g | 871.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A108677 |
2-chloro-3,4-difluorobenzoic acid (CAS 150444-93-2) is a chemical compound with the molecular formula C7H3ClF2O2 and a molecular weight of 192.55 g/mol. IUPAC name: 2-chloro-3,4-difluorobenzoic acid. InChIKey: OXEOUORGNJUNFN-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF2O2 |
|---|---|
| Molecular weight | 192.55 g/mol |
| IUPAC name | 2-chloro-3,4-difluorobenzoic acid |
| InChIKey | OXEOUORGNJUNFN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(=O)O)Cl)F)F |
Computed by PubChem (NCBI)