cas: 150444-93-2 — see every product listed under this CAS number, including other names
2-Chloro-3,4-difluorobenzoic acid, 95%, 95% (CAS 150444-93-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112MLV-100mg |
| cas | 150444-93-2 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 112.40 Pln | |
| Chemat | 250mg | 136.40 Pln | |
| Chemat | 1g | 256.40 Pln | |
| Chemat | 5g | 750.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-chloro-3,4-difluorobenzoic acid (CAS 150444-93-2) is a chemical compound with the molecular formula C7H3ClF2O2 and a molecular weight of 192.55 g/mol. IUPAC name: 2-chloro-3,4-difluorobenzoic acid. InChIKey: OXEOUORGNJUNFN-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF2O2 |
|---|---|
| Molecular weight | 192.55 g/mol |
| IUPAC name | 2-chloro-3,4-difluorobenzoic acid |
| InChIKey | OXEOUORGNJUNFN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(=O)O)Cl)F)F |
Computed by PubChem (NCBI)