cas: 41122-35-4 — see every product listed under this CAS number, including other names
2-Chloro-3,4-dimethoxy-1-(2-nitroethenyl)benzene, 95%, 95% (CAS 41122-35-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114UW4-100mg |
| cas | 41122-35-4 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 270.80 Pln | |
| Chemat | 250mg | 405.20 Pln | |
| Chemat | 1g | 750.80 Pln | |
| Chemat | 5g | 2128.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3-chloro-1,2-dimethoxy-4-[(E)-2-nitroethenyl]benzene (CAS 41122-35-4) is a chemical compound with the molecular formula C10H10ClNO4 and a molecular weight of 243.64 g/mol. IUPAC name: 3-chloro-1,2-dimethoxy-4-[(E)-2-nitroethenyl]benzene. InChIKey: PXDQNCVFROGRNW-AATRIKPKSA-N.
| Molecular formula | C10H10ClNO4 |
|---|---|
| Molecular weight | 243.64 g/mol |
| IUPAC name | 3-chloro-1,2-dimethoxy-4-[(E)-2-nitroethenyl]benzene |
| InChIKey | PXDQNCVFROGRNW-AATRIKPKSA-N |
| SMILES | COC1=C(C(=C(C=C1)/C=C/[N+](=O)[O-])Cl)OC |
Computed by PubChem (NCBI)