Products 1160257-28-2
CAS 1160257-28-2 is the registry number for 2-(4-Methyl-2-nitrophenoxy)propanoyl chloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
2-(4-methyl-2-nitrophenoxy)propanoyl chloride (CAS 1160257-28-2) is a chemical compound with the molecular formula C10H10ClNO4 and a molecular weight of 243.64 g/mol. IUPAC name: 2-(4-methyl-2-nitrophenoxy)propanoyl chloride. InChIKey: LXOJOTMFPMSXRJ-UHFFFAOYSA-N.
| Molecular formula | C10H10ClNO4 |
|---|---|
| Molecular weight | 243.64 g/mol |
| IUPAC name | 2-(4-methyl-2-nitrophenoxy)propanoyl chloride |
| InChIKey | LXOJOTMFPMSXRJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)OC(C)C(=O)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)