CAS 871126-37-3 is the registry number for Trans-3-chloro-4,5-dimethoxy-beta-nitrostyrene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
1-chloro-2,3-dimethoxy-5-[(E)-2-nitroethenyl]benzene (CAS 871126-37-3) is a chemical compound with the molecular formula C10H10ClNO4 and a molecular weight of 243.64 g/mol. IUPAC name: 1-chloro-2,3-dimethoxy-5-[(E)-2-nitroethenyl]benzene. InChIKey: AYULBTLOYLJHSB-ONEGZZNKSA-N.
| Molecular formula | C10H10ClNO4 |
|---|---|
| Molecular weight | 243.64 g/mol |
| IUPAC name | 1-chloro-2,3-dimethoxy-5-[(E)-2-nitroethenyl]benzene |
| InChIKey | AYULBTLOYLJHSB-ONEGZZNKSA-N |
| SMILES | COC1=C(C(=CC(=C1)/C=C/[N+](=O)[O-])Cl)OC |
Computed by PubChem (NCBI)