CAS 2655608-50-5 is the registry number for 4-Nitro-2-propoxybenzoyl chloride, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
4-nitro-2-propoxybenzoyl chloride (CAS 2655608-50-5) is a chemical compound with the molecular formula C10H10ClNO4 and a molecular weight of 243.64 g/mol. IUPAC name: 4-nitro-2-propoxybenzoyl chloride. InChIKey: OSWRTNDXKGCORP-UHFFFAOYSA-N.
| Molecular formula | C10H10ClNO4 |
|---|---|
| Molecular weight | 243.64 g/mol |
| IUPAC name | 4-nitro-2-propoxybenzoyl chloride |
| InChIKey | OSWRTNDXKGCORP-UHFFFAOYSA-N |
| SMILES | CCCOC1=C(C=CC(=C1)[N+](=O)[O-])C(=O)Cl |
Computed by PubChem (NCBI)