cas: 102940-86-3 — see every product listed under this CAS number, including other names
2-Chloro-3-fluorobenzoic acid 97% (CAS 102940-86-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A230961-1g |
| cas | 102940-86-3 |
| size | 1g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 142.31 Pln | |
| Ambeed | 10g | 209.06 Pln | |
| Ambeed | 25g | 253.56 Pln | |
| Ambeed | 100g | 798.69 Pln | |
| Ambeed | 500g | 3702.31 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A230961 |
2-chloro-3-fluorobenzoic acid (CAS 102940-86-3) is a chemical compound with the molecular formula C7H4ClFO2 and a molecular weight of 174.55 g/mol. IUPAC name: 2-chloro-3-fluorobenzoic acid. InChIKey: WJYAYXKXZNITAZ-UHFFFAOYSA-N.
| Molecular formula | C7H4ClFO2 |
|---|---|
| Molecular weight | 174.55 g/mol |
| IUPAC name | 2-chloro-3-fluorobenzoic acid |
| InChIKey | WJYAYXKXZNITAZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)Cl)C(=O)O |
Computed by PubChem (NCBI)