2-Chloro-3-fluoropyridine-4-boronic Acid, 98%, 98%
cas: 937595-71-6 — see every product listed under this CAS number, including other names
2-Chloro-3-fluoropyridine-4-boronic Acid, 98%, 98% (CAS 937595-71-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114GVJ-250mg |
| cas | 937595-71-6 |
| size | 250mg |
| availability | 1000g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 117.20 Pln | |
| Chemat | 10g | 174.80 Pln | |
| Chemat | 25g | 338.00 Pln | |
| Chemat | 50g | 578.00 Pln | |
| Chemat | 100g | 1029.20 Pln | |
| Chemat | 250g | 2128.40 Pln | |
| Chemat | 500g | 3715.20 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2-chloro-3-fluoro-4-pyridinyl)boronic acid (CAS 937595-71-6) is a chemical compound with the molecular formula C5H4BClFNO2 and a molecular weight of 175.35 g/mol. IUPAC name: (2-chloro-3-fluoro-4-pyridinyl)boronic acid. InChIKey: ZXGCWGYBIXCFMP-UHFFFAOYSA-N.
| Molecular formula | C5H4BClFNO2 |
|---|---|
| Molecular weight | 175.35 g/mol |
| IUPAC name | (2-chloro-3-fluoro-4-pyridinyl)boronic acid |
| InChIKey | ZXGCWGYBIXCFMP-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=NC=C1)Cl)F)(O)O |
Computed by PubChem (NCBI)
Synonyms:
2-Chloro-3-fluoropyridine-4-boronic acid, (2-chloro-3-fluoropyridin-4-yl)boronic acid, (2-chloro-3-fluoro-4-pyridyl)boronic acid, 2-chloro-3-fluoropyridin-4-ylboronic acid, 2-Chloro-3-Fluoropyridine-4-BoronicAcid, ZXGCWGYBIXCFMP-UHFFFAOYS, ZXGCWGYBIXCFMP-UHFFFAOYSA-N, Boronic acid, B-(2-chloro-3-fluoro-4-pyridinyl)-, 2-Chloro-3-fluoropyridine-4-boronic acid(contains varying amounts of Anhydride)