2-Chloro-3-nitrophenol, 97%, 97%
cas: 603-84-9 — see every product listed under this CAS number, including other names
2-Chloro-3-nitrophenol, 97%, 97% (CAS 603-84-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 50g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114GW2-250mg |
| cas | 603-84-9 |
| size | 250mg |
| availability | 1000g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 146.00 Pln | |
| Chemat | 10g | 232.40 Pln | |
| Chemat | 25g | 467.60 Pln | |
| Chemat | 100g | 1686.80 Pln | |
| Chemat | 50g | 875.60 Pln | |
| Chemat | 250g | 3851.60 Pln | |
| Chemat | 500g | 7022.40 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-chloro-3-nitrophenol (CAS 603-84-9) is a chemical compound with the molecular formula C6H4ClNO3 and a molecular weight of 173.55 g/mol. IUPAC name: 2-chloro-3-nitrophenol. InChIKey: QBGLHYQUZJDZOO-UHFFFAOYSA-N.
| Molecular formula | C6H4ClNO3 |
|---|---|
| Molecular weight | 173.55 g/mol |
| IUPAC name | 2-chloro-3-nitrophenol |
| InChIKey | QBGLHYQUZJDZOO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)O)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)