CAS 103997-21-3 appears in our catalog under these names: 5-Chloro-6-oxo-1,6-dihydropyridine-2-carboxylic acid, 95%, 5-Chloro-6-oxo-1,6-dihydropyridine-2-carboxylic acid 98%, 5-Chloro-6-oxo-1,6-dihydropyridine-2-carboxylic acid, 98%, 98%, 5-Chloro-6-oxo-1,6-dihydropyridine-2-carboxylic acid, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 10g, 5g.
5-chloro-6-oxo-1H-pyridine-2-carboxylic acid (CAS 103997-21-3) is a chemical compound with the molecular formula C6H4ClNO3 and a molecular weight of 173.55 g/mol. IUPAC name: 5-chloro-6-oxo-1H-pyridine-2-carboxylic acid. InChIKey: GJCDETCQSYSYFT-UHFFFAOYSA-N.
| Molecular formula | C6H4ClNO3 |
|---|---|
| Molecular weight | 173.55 g/mol |
| IUPAC name | 5-chloro-6-oxo-1H-pyridine-2-carboxylic acid |
| InChIKey | GJCDETCQSYSYFT-UHFFFAOYSA-N |
| SMILES | C1=C(C(=O)NC(=C1)C(=O)O)Cl |
Computed by PubChem (NCBI)