Products 1211531-26-8

CAS 1211531-26-8 is the registry number for 6-Chloro-5-hydroxynicotinic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg.

Structural formula: {0} (CAS {1})

6-chloro-5-hydroxypyridine-3-carboxylic acid (CAS 1211531-26-8) is a chemical compound with the molecular formula C6H4ClNO3 and a molecular weight of 173.55 g/mol. IUPAC name: 6-chloro-5-hydroxypyridine-3-carboxylic acid. InChIKey: ADPSGDNEIGPGEW-UHFFFAOYSA-N.

Identity
Molecular formulaC6H4ClNO3
Molecular weight173.55 g/mol
IUPAC name6-chloro-5-hydroxypyridine-3-carboxylic acid
InChIKeyADPSGDNEIGPGEW-UHFFFAOYSA-N
SMILESC1=C(C=NC(=C1O)Cl)C(=O)O

Computed by PubChem (NCBI)