CAS 603-84-9 appears in our catalog under these names: 2–Chloro–3–nitrophenol, 2-Chloro-3-nitrophenol 97%, 2-Chloro-3-nitrophenol, 97%, 97%, 2-Chloro-3-nitrophenol, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 25g, 5g, 250mg, 1g, 10g, 50g, 250g.
2-chloro-3-nitrophenol (CAS 603-84-9) is a chemical compound with the molecular formula C6H4ClNO3 and a molecular weight of 173.55 g/mol. IUPAC name: 2-chloro-3-nitrophenol. InChIKey: QBGLHYQUZJDZOO-UHFFFAOYSA-N.
| Molecular formula | C6H4ClNO3 |
|---|---|
| Molecular weight | 173.55 g/mol |
| IUPAC name | 2-chloro-3-nitrophenol |
| InChIKey | QBGLHYQUZJDZOO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)O)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)