2-Chloro-4-fluoro-5-nitropyridine, 95%
cas: 1261803-05-7 — see every product listed under this CAS number, including other names
2-Chloro-4-fluoro-5-nitropyridine, 95% (CAS 1261803-05-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 50mg, 100mg. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A124045-250mg |
| cas | 1261803-05-7 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 3307.38 Pln | |
| Ambeed | 1g | 9203.62 Pln | |
| Ambeed | 5g | 36604.50 Pln | |
| BLDpharm | 50mg | 1452.85 Pln | |
| BLDpharm | 100mg | 2202.58 Pln | |
| BLDpharm | 250mg | 3241.11 Pln | |
| BLDpharm | 1g | 9022.40 Pln | |
| BLDpharm | 5g | 35879.61 Pln | |
| Chemat | 50mg | 1096.40 Pln | |
| Chemat | 100mg | 1643.60 Pln | |
| Chemat | 250mg | 2430.80 Pln | |
| Chemat | 1g | 6750.80 Pln | |
| Chemat | 5g | 26805.20 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
2-chloro-4-fluoro-5-nitropyridine (CAS 1261803-05-7) is a chemical compound with the molecular formula C5H2ClFN2O2 and a molecular weight of 176.53 g/mol. IUPAC name: 2-chloro-4-fluoro-5-nitropyridine. InChIKey: HPMWWSWKKAAVSW-UHFFFAOYSA-N.
| Molecular formula | C5H2ClFN2O2 |
|---|---|
| Molecular weight | 176.53 g/mol |
| IUPAC name | 2-chloro-4-fluoro-5-nitropyridine |
| InChIKey | HPMWWSWKKAAVSW-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CN=C1Cl)[N+](=O)[O-])F |
Computed by PubChem (NCBI)