cas: 5568-33-2 — see every product listed under this CAS number, including other names
2-Chloro-4-nitrobenzaldehyde 98% (CAS 5568-33-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A352008-250mg |
| cas | 5568-33-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 392.62 Pln | |
| Ambeed | 1g | 698.56 Pln | |
| Ambeed | 5g | 1955.69 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A352008 |
2-chloro-4-nitrobenzaldehyde (CAS 5568-33-2) is a chemical compound with the molecular formula C7H4ClNO3 and a molecular weight of 185.56 g/mol. IUPAC name: 2-chloro-4-nitrobenzaldehyde. InChIKey: GVBXZIANHMNKAK-UHFFFAOYSA-N.
| Molecular formula | C7H4ClNO3 |
|---|---|
| Molecular weight | 185.56 g/mol |
| IUPAC name | 2-chloro-4-nitrobenzaldehyde |
| InChIKey | GVBXZIANHMNKAK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])Cl)C=O |
Computed by PubChem (NCBI)