CAS 121-90-4 appears in our catalog under these names: 3-Nitrobenzoyl chloride, 97%, 3-Nitrobenzoyl Chloride, 3-Nitrobenzoyl chloride, 98% , 3-Nitrobenzoyl Chloride, >98.0%(GC)(T), 3-Nitrobenzoyl chloride, 98%. Offered by: Combi-blocks, TRC, Thermo Scientific (Alfa Aesar), TCI, Thermo Scientific (Acros). Available pack sizes: 500g, 100g, 25g, 10mg, 1mg, 50g, 250g, 5g.
3-nitrobenzoyl chloride (CAS 121-90-4) is a chemical compound with the molecular formula C7H4ClNO3 and a molecular weight of 185.56 g/mol. IUPAC name: 3-nitrobenzoyl chloride. InChIKey: NXTNASSYJUXJDV-UHFFFAOYSA-N.
| Molecular formula | C7H4ClNO3 |
|---|---|
| Molecular weight | 185.56 g/mol |
| IUPAC name | 3-nitrobenzoyl chloride |
| InChIKey | NXTNASSYJUXJDV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])C(=O)Cl |
Computed by PubChem (NCBI)