CAS 610-14-0 is the registry number for 2-Nitrobenzoyl chloride, 97%. Offered by: Combi-blocks, Sigma-Aldrich. Available pack sizes: 25g, 5g, 100g, 1g.
2-nitrobenzoyl chloride (CAS 610-14-0) is a chemical compound with the molecular formula C7H4ClNO3 and a molecular weight of 185.56 g/mol. IUPAC name: 2-nitrobenzoyl chloride. InChIKey: BWWHTIHDQBHTHP-UHFFFAOYSA-N.
| Molecular formula | C7H4ClNO3 |
|---|---|
| Molecular weight | 185.56 g/mol |
| IUPAC name | 2-nitrobenzoyl chloride |
| InChIKey | BWWHTIHDQBHTHP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)