Products 610-14-0
CAS 610-14-0 appears in our catalog under these names: 2-Nitrobenzoyl chloride, 97%, 2-Nitrobenzoyl chloride 97 %. Offered by: Combi-blocks, Sigma-Aldrich. Available pack sizes: 25g, 5g, 100g, 1g.
2-nitrobenzoyl chloride (CAS 610-14-0) is a chemical compound with the molecular formula C7H4ClNO3 and a molecular weight of 185.56 g/mol. IUPAC name: 2-nitrobenzoyl chloride. InChIKey: BWWHTIHDQBHTHP-UHFFFAOYSA-N.
| Molecular formula | C7H4ClNO3 |
|---|---|
| Molecular weight | 185.56 g/mol |
| IUPAC name | 2-nitrobenzoyl chloride |
| InChIKey | BWWHTIHDQBHTHP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
2-Nitrobenzoyl chloride, O-NITROBENZOYL CHLORIDE, Benzoyl chloride, 2-nitro-, o-nitrobenzoic acid chloride, NITROBENZOYL CHLORIDE, O-, 4-09-00-01049 (Beilstein Handbook Reference), 2-nitro benzoyl chloride, ORTHO-NITROBENZOYL CHLORIDE, BWWHTIHDQBHTHP-UHFFFAOYSA-N, Benzoyl chloride, o-nitro-