CAS 122-04-3 appears in our catalog under these names: 4-Nitrobenzoyl chloride, 98%, 4-Nitrobenzoyl Chloride, 4-Nitrobenzoyl chloride, 98% , 4-Nitrobenzoyl Chloride, >98.0%(GC)(T). Offered by: Combi-blocks, TRC, Thermo Scientific (Alfa Aesar), TCI, Thermo Scientific (Acros). Available pack sizes: 500g, 25g, 100g, 50g, 10g, 1000g, 250g, 5g.
4-nitrobenzoyl chloride (CAS 122-04-3) is a chemical compound with the molecular formula C7H4ClNO3 and a molecular weight of 185.56 g/mol. IUPAC name: 4-nitrobenzoyl chloride. InChIKey: SKDHHIUENRGTHK-UHFFFAOYSA-N.
| Molecular formula | C7H4ClNO3 |
|---|---|
| Molecular weight | 185.56 g/mol |
| IUPAC name | 4-nitrobenzoyl chloride |
| InChIKey | SKDHHIUENRGTHK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)