cas: 53297-68-0 — see every product listed under this CAS number, including other names
2-Chloro-4-sulfamoylaniline 97% (CAS 53297-68-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A374841-1g |
| cas | 53297-68-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 214.62 Pln | |
| Ambeed | 10g | 353.69 Pln | |
| Ambeed | 25g | 648.50 Pln | |
| Ambeed | 100g | 1805.50 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A374841 |
4-amino-3-chlorobenzenesulfonamide (CAS 53297-68-0) is a chemical compound with the molecular formula C6H7ClN2O2S and a molecular weight of 206.65 g/mol. IUPAC name: 4-amino-3-chlorobenzenesulfonamide. InChIKey: LFIOFZKZCDMGFG-UHFFFAOYSA-N.
| Molecular formula | C6H7ClN2O2S |
|---|---|
| Molecular weight | 206.65 g/mol |
| IUPAC name | 4-amino-3-chlorobenzenesulfonamide |
| InChIKey | LFIOFZKZCDMGFG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1S(=O)(=O)N)Cl)N |
Computed by PubChem (NCBI)