2-Chloro-4-trifluoromethoxyphenol
cas: 70783-75-4 — see every product listed under this CAS number, including other names
2-Chloro-4-trifluoromethoxyphenol (CAS 70783-75-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F024882-1G |
| cas | 70783-75-4 |
| size | 1g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 502.97 Pln | |
| Fluorochem | 5g | 1440.14 Pln | |
| Fluorochem | 10g | 2549.12 Pln | |
| Fluorochem | 25g | 4251.65 Pln | |
| Fluorochem | 100g | 11608.43 Pln |
properties
| delivery time | 2-3 weeks |
|---|
2-chloro-4-(trifluoromethoxy)phenol (CAS 70783-75-4) is a chemical compound with the molecular formula C7H4ClF3O2 and a molecular weight of 212.55 g/mol. IUPAC name: 2-chloro-4-(trifluoromethoxy)phenol. InChIKey: LSTYNKXVEMLNBE-UHFFFAOYSA-N.
| Molecular formula | C7H4ClF3O2 |
|---|---|
| Molecular weight | 212.55 g/mol |
| IUPAC name | 2-chloro-4-(trifluoromethoxy)phenol |
| InChIKey | LSTYNKXVEMLNBE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OC(F)(F)F)Cl)O |
Computed by PubChem (NCBI)