cas: 331-26-0 — see every product listed under this CAS number, including other names
2-Chloro-5-(trifluoromethoxy)aniline 98% (CAS 331-26-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A328325-250mg |
| cas | 331-26-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 253.56 Pln | |
| Ambeed | 1g | 292.50 Pln | |
| Ambeed | 5g | 542.81 Pln | |
| Ambeed | 25g | 1850.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A328325 |
2-chloro-5-(trifluoromethoxy)aniline (CAS 331-26-0) is a chemical compound with the molecular formula C7H5ClF3NO and a molecular weight of 211.57 g/mol. IUPAC name: 2-chloro-5-(trifluoromethoxy)aniline. InChIKey: BRHNMISYMABKDU-UHFFFAOYSA-N.
| Molecular formula | C7H5ClF3NO |
|---|---|
| Molecular weight | 211.57 g/mol |
| IUPAC name | 2-chloro-5-(trifluoromethoxy)aniline |
| InChIKey | BRHNMISYMABKDU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OC(F)(F)F)N)Cl |
Computed by PubChem (NCBI)