cas: 536693-96-6 — see every product listed under this CAS number, including other names
2-Chloro-5-(trifluoromethyl)pyridine-3-boronic acid (CAS 536693-96-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F219415-250MG |
| cas | 536693-96-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 294.71 Pln | |
| Fluorochem | 1g | 653.95 Pln |
| delivery time | 3-4 weeks |
|---|
[2-chloro-5-(trifluoromethyl)-3-pyridinyl]boronic acid (CAS 536693-96-6) is a chemical compound with the molecular formula C6H4BClF3NO2 and a molecular weight of 225.36 g/mol. IUPAC name: [2-chloro-5-(trifluoromethyl)-3-pyridinyl]boronic acid. InChIKey: OJUNKVOTAZHNAL-UHFFFAOYSA-N.
| Molecular formula | C6H4BClF3NO2 |
|---|---|
| Molecular weight | 225.36 g/mol |
| IUPAC name | [2-chloro-5-(trifluoromethyl)-3-pyridinyl]boronic acid |
| InChIKey | OJUNKVOTAZHNAL-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CN=C1Cl)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)