cas: 1208081-98-4 — see every product listed under this CAS number, including other names
2-Chloro-5-methylpyridine-3-sulfonyl chloride 97% (CAS 1208081-98-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A156026-250mg |
| cas | 1208081-98-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 225.75 Pln | |
| Ambeed | 5g | 743.06 Pln | |
| Ambeed | 10g | 1366.06 Pln | |
| Ambeed | 25g | 2656.56 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A156026 |
2-chloro-5-methylpyridine-3-sulfonyl chloride (CAS 1208081-98-4) is a chemical compound with the molecular formula C6H5Cl2NO2S and a molecular weight of 226.08 g/mol. IUPAC name: 2-chloro-5-methylpyridine-3-sulfonyl chloride. InChIKey: BVVCMKNJSMDRPV-UHFFFAOYSA-N.
| Molecular formula | C6H5Cl2NO2S |
|---|---|
| Molecular weight | 226.08 g/mol |
| IUPAC name | 2-chloro-5-methylpyridine-3-sulfonyl chloride |
| InChIKey | BVVCMKNJSMDRPV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(N=C1)Cl)S(=O)(=O)Cl |
Computed by PubChem (NCBI)