cas: 1208081-98-4 — see every product listed under this CAS number, including other names
2-Chloro-5-methylpyridine-3-sulfonyl chloride, 98%, 98% (CAS 1208081-98-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 100mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12A3U9-250mg |
| cas | 1208081-98-4 |
| size | 250mg |
| availability | 125g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 100mg | 102.80 Pln | |
| Chemat | 1g | 184.40 Pln | |
| Chemat | 5g | 573.20 Pln | |
| Chemat | 10g | 1053.20 Pln | |
| Chemat | 25g | 2046.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-chloro-5-methylpyridine-3-sulfonyl chloride (CAS 1208081-98-4) is a chemical compound with the molecular formula C6H5Cl2NO2S and a molecular weight of 226.08 g/mol. IUPAC name: 2-chloro-5-methylpyridine-3-sulfonyl chloride. InChIKey: BVVCMKNJSMDRPV-UHFFFAOYSA-N.
| Molecular formula | C6H5Cl2NO2S |
|---|---|
| Molecular weight | 226.08 g/mol |
| IUPAC name | 2-chloro-5-methylpyridine-3-sulfonyl chloride |
| InChIKey | BVVCMKNJSMDRPV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(N=C1)Cl)S(=O)(=O)Cl |
Computed by PubChem (NCBI)