cas: 731002-60-1 — see every product listed under this CAS number, including other names
2-Chloro-6-(trifluoromethyl)pyridin-3-ol, 97% (CAS 731002-60-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F614550-250MG |
| cas | 731002-60-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 237.43 Pln | |
| Fluorochem | 500mg | 357.18 Pln | |
| Fluorochem | 1g | 643.54 Pln | |
| Fluorochem | 5g | 2434.58 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-chloro-6-(trifluoromethyl)pyridin-3-ol (CAS 731002-60-1) is a chemical compound with the molecular formula C6H3ClF3NO and a molecular weight of 197.54 g/mol. IUPAC name: 2-chloro-6-(trifluoromethyl)pyridin-3-ol. InChIKey: GNWCKTRJDNPOFC-UHFFFAOYSA-N.
| Molecular formula | C6H3ClF3NO |
|---|---|
| Molecular weight | 197.54 g/mol |
| IUPAC name | 2-chloro-6-(trifluoromethyl)pyridin-3-ol |
| InChIKey | GNWCKTRJDNPOFC-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1O)Cl)C(F)(F)F |
Computed by PubChem (NCBI)