CAS 164464-58-8 is the registry number for 2-Chloro-4-(trifluoromethyl)pyridin-1-ium-1-olate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2-chloro-1-oxido-4-(trifluoromethyl)pyridin-1-ium (CAS 164464-58-8) is a chemical compound with the molecular formula C6H3ClF3NO and a molecular weight of 197.54 g/mol. IUPAC name: 2-chloro-1-oxido-4-(trifluoromethyl)pyridin-1-ium. InChIKey: PPXDPRCUEAXEIF-UHFFFAOYSA-N.
| Molecular formula | C6H3ClF3NO |
|---|---|
| Molecular weight | 197.54 g/mol |
| IUPAC name | 2-chloro-1-oxido-4-(trifluoromethyl)pyridin-1-ium |
| InChIKey | PPXDPRCUEAXEIF-UHFFFAOYSA-N |
| SMILES | C1=C[N+](=C(C=C1C(F)(F)F)Cl)[O-] |
Computed by PubChem (NCBI)