CAS 76041-77-5 is the registry number for 6-Chloro-5-(trifluoromethyl)pyridin-2(1H)-one, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
6-chloro-5-(trifluoromethyl)-1H-pyridin-2-one (CAS 76041-77-5) is a chemical compound with the molecular formula C6H3ClF3NO and a molecular weight of 197.54 g/mol. IUPAC name: 6-chloro-5-(trifluoromethyl)-1H-pyridin-2-one. InChIKey: ZPBMRUGPARPEBB-UHFFFAOYSA-N.
| Molecular formula | C6H3ClF3NO |
|---|---|
| Molecular weight | 197.54 g/mol |
| IUPAC name | 6-chloro-5-(trifluoromethyl)-1H-pyridin-2-one |
| InChIKey | ZPBMRUGPARPEBB-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)NC(=C1C(F)(F)F)Cl |
Computed by PubChem (NCBI)