CAS 34486-07-2 is the registry number for 6-Chloro-4-(trifluoromethyl)pyridin-2-ol, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
6-chloro-4-(trifluoromethyl)-1H-pyridin-2-one (CAS 34486-07-2) is a chemical compound with the molecular formula C6H3ClF3NO and a molecular weight of 197.54 g/mol. IUPAC name: 6-chloro-4-(trifluoromethyl)-1H-pyridin-2-one. InChIKey: JZOPIRBGKBVIEO-UHFFFAOYSA-N.
| Molecular formula | C6H3ClF3NO |
|---|---|
| Molecular weight | 197.54 g/mol |
| IUPAC name | 6-chloro-4-(trifluoromethyl)-1H-pyridin-2-one |
| InChIKey | JZOPIRBGKBVIEO-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(NC1=O)Cl)C(F)(F)F |
Computed by PubChem (NCBI)