2-Chloro-6-methoxynaphthalene, 97%
cas: 67886-68-4 — see every product listed under this CAS number, including other names
2-Chloro-6-methoxynaphthalene, 97% (CAS 67886-68-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A696890-250mg |
| cas | 67886-68-4 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 626.25 Pln | |
| Ambeed | 1g | 1377.19 Pln | |
| Ambeed | 5g | 3691.19 Pln | |
| BLDpharm | 250mg | 669.79 Pln | |
| BLDpharm | 1g | 1480.61 Pln | |
| BLDpharm | 5g | 3974.18 Pln | |
| Chemat | 250mg | 683.60 Pln | |
| Chemat | 1g | 1782.80 Pln | |
| Chemat | 5g | 6083.60 Pln | |
| Fluorochem | 250mg | 1263.11 Pln | |
| Fluorochem | 1g | 3293.65 Pln | |
| Fluorochem | 5g | 11098.19 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
2-chloro-6-methoxynaphthalene (CAS 67886-68-4) is a chemical compound with the molecular formula C11H9ClO and a molecular weight of 192.64 g/mol. IUPAC name: 2-chloro-6-methoxynaphthalene. InChIKey: DFJBXCAVJOGNDS-UHFFFAOYSA-N.
| Molecular formula | C11H9ClO |
|---|---|
| Molecular weight | 192.64 g/mol |
| IUPAC name | 2-chloro-6-methoxynaphthalene |
| InChIKey | DFJBXCAVJOGNDS-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C=C(C=C2)Cl |
Computed by PubChem (NCBI)