CAS 1613309-12-8 appears in our catalog under these names: (4E)-5-(4-Chlorophenyl)penta-1,4-dien-3-one, E, 95% +(stabilized with TBC), (4E)-5-(4-Chlorophenyl)penta-1,4-dien-3-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
(1E)-1-(4-chlorophenyl)penta-1,4-dien-3-one (CAS 1613309-12-8) is a chemical compound with the molecular formula C11H9ClO and a molecular weight of 192.64 g/mol. IUPAC name: (1E)-1-(4-chlorophenyl)penta-1,4-dien-3-one. InChIKey: YFOMCUJFCGJLJI-VMPITWQZSA-N.
| Molecular formula | C11H9ClO |
|---|---|
| Molecular weight | 192.64 g/mol |
| IUPAC name | (1E)-1-(4-chlorophenyl)penta-1,4-dien-3-one |
| InChIKey | YFOMCUJFCGJLJI-VMPITWQZSA-N |
| SMILES | C=CC(=O)/C=C/C1=CC=C(C=C1)Cl |
Computed by PubChem (NCBI)