CAS 3262-03-1 is the registry number for 1-Chloro-3,4-dihydronaphthalene-2-carbaldehyde, 98%(GC-MS),RG, 98%(GC-MS),RG. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
1-chloro-3,4-dihydronaphthalene-2-carbaldehyde (CAS 3262-03-1) is a chemical compound with the molecular formula C11H9ClO and a molecular weight of 192.64 g/mol. IUPAC name: 1-chloro-3,4-dihydronaphthalene-2-carbaldehyde. InChIKey: GBRFPPIJEHQBGK-UHFFFAOYSA-N.
| Molecular formula | C11H9ClO |
|---|---|
| Molecular weight | 192.64 g/mol |
| IUPAC name | 1-chloro-3,4-dihydronaphthalene-2-carbaldehyde |
| InChIKey | GBRFPPIJEHQBGK-UHFFFAOYSA-N |
| SMILES | C1CC(=C(C2=CC=CC=C21)Cl)C=O |
Computed by PubChem (NCBI)