Products 2891598-65-3
CAS 2891598-65-3 is the registry number for 4-chloro-3-methyl-naphthalen-2-ol, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
4-chloro-3-methylnaphthalen-2-ol (CAS 2891598-65-3) is a chemical compound with the molecular formula C11H9ClO and a molecular weight of 192.64 g/mol. IUPAC name: 4-chloro-3-methylnaphthalen-2-ol. InChIKey: UWRHWMFVMQXJNO-UHFFFAOYSA-N.
| Molecular formula | C11H9ClO |
|---|---|
| Molecular weight | 192.64 g/mol |
| IUPAC name | 4-chloro-3-methylnaphthalen-2-ol |
| InChIKey | UWRHWMFVMQXJNO-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=CC=CC=C2C=C1O)Cl |
Computed by PubChem (NCBI)