cas: 13600-48-1 — see every product listed under this CAS number, including other names
2-Chloro-6-methyl-4-(trifluoromethyl)nicotinonitrile, 97% (CAS 13600-48-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F047329-100MG |
| cas | 13600-48-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 143.72 Pln | |
| Fluorochem | 250mg | 190.58 Pln | |
| Fluorochem | 500mg | 258.26 Pln | |
| Fluorochem | 1g | 294.71 Pln | |
| Fluorochem | 5g | 721.64 Pln | |
| Fluorochem | 10g | 1382.86 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-chloro-6-methyl-4-(trifluoromethyl)pyridine-3-carbonitrile (CAS 13600-48-1) is a chemical compound with the molecular formula C8H4ClF3N2 and a molecular weight of 220.58 g/mol. IUPAC name: 2-chloro-6-methyl-4-(trifluoromethyl)pyridine-3-carbonitrile. InChIKey: LNJOJFNFYGSCCR-UHFFFAOYSA-N.
| Molecular formula | C8H4ClF3N2 |
|---|---|
| Molecular weight | 220.58 g/mol |
| IUPAC name | 2-chloro-6-methyl-4-(trifluoromethyl)pyridine-3-carbonitrile |
| InChIKey | LNJOJFNFYGSCCR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=N1)Cl)C#N)C(F)(F)F |
Computed by PubChem (NCBI)