Products 124467-36-3
CAS 124467-36-3 appears in our catalog under these names: 2–Chloro–7，8–dihydroquinolin–5(6H)–one, 2-Chloro-7,8-dihydroquinolin-5(6H)-one, 97%. Offered by: GLPBio, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg, 25g.
2-chloro-7,8-dihydro-6H-quinolin-5-one (CAS 124467-36-3) is a chemical compound with the molecular formula C9H8ClNO and a molecular weight of 181.62 g/mol. IUPAC name: 2-chloro-7,8-dihydro-6H-quinolin-5-one. InChIKey: GWDDFDLEOYOZLY-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNO |
|---|---|
| Molecular weight | 181.62 g/mol |
| IUPAC name | 2-chloro-7,8-dihydro-6H-quinolin-5-one |
| InChIKey | GWDDFDLEOYOZLY-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC(=N2)Cl)C(=O)C1 |
Computed by PubChem (NCBI)