2-Chloro-N-(piperidin-3-yl)nicotinamide hydrochloride, 95%
cas: 1353972-64-1 — see every product listed under this CAS number, including other names
2-Chloro-N-(piperidin-3-yl)nicotinamide hydrochloride, 95% (CAS 1353972-64-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A781480-100mg |
| cas | 1353972-64-1 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 342.56 Pln | |
| Ambeed | 250mg | 531.69 Pln | |
| Ambeed | 1g | 1321.56 Pln | |
| Chemat | 100mg | 314.00 Pln | |
| Chemat | 250mg | 486.80 Pln | |
| Chemat | 1g | 1202.00 Pln | |
| BLDpharm | 100mg | 336.57 Pln | |
| BLDpharm | 250mg | 519.84 Pln | |
| BLDpharm | 1g | 1297.35 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
2-chloro-N-piperidin-3-ylpyridine-3-carboxamide;hydrochloride (CAS 1353972-64-1) is a chemical compound with the molecular formula C11H15Cl2N3O and a molecular weight of 276.16 g/mol. IUPAC name: 2-chloro-N-piperidin-3-ylpyridine-3-carboxamide;hydrochloride. InChIKey: BHWDMXGRQIXVOX-UHFFFAOYSA-N.
| Molecular formula | C11H15Cl2N3O |
|---|---|
| Molecular weight | 276.16 g/mol |
| IUPAC name | 2-chloro-N-piperidin-3-ylpyridine-3-carboxamide;hydrochloride |
| InChIKey | BHWDMXGRQIXVOX-UHFFFAOYSA-N |
| SMILES | C1CC(CNC1)NC(=O)C2=C(N=CC=C2)Cl.Cl |
Computed by PubChem (NCBI)