CAS 1503503-78-3 appears in our catalog under these names: 2-Morpholin-2-yl-1h-pyrrolo[2,3-b]pyridine dihydrochloride, 95%, 2-MOrpholin-2-yl-1h-pyrrolo(2,3-b)pyridine dihydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
2-(1H-pyrrolo[2,3-b]pyridin-2-yl)morpholine;dihydrochloride (CAS 1503503-78-3) is a chemical compound with the molecular formula C11H15Cl2N3O and a molecular weight of 276.16 g/mol. IUPAC name: 2-(1H-pyrrolo[2,3-b]pyridin-2-yl)morpholine;dihydrochloride. InChIKey: ZIGBGRVMTSVGTJ-UHFFFAOYSA-N.
| Molecular formula | C11H15Cl2N3O |
|---|---|
| Molecular weight | 276.16 g/mol |
| IUPAC name | 2-(1H-pyrrolo[2,3-b]pyridin-2-yl)morpholine;dihydrochloride |
| InChIKey | ZIGBGRVMTSVGTJ-UHFFFAOYSA-N |
| SMILES | C1COC(CN1)C2=CC3=C(N2)N=CC=C3.Cl.Cl |
Computed by PubChem (NCBI)