CAS 1170255-29-4 is the registry number for N-(3-Chlorophenyl)piperazine-1-carboxamide hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 5g.
N-(3-chlorophenyl)piperazine-1-carboxamide;hydrochloride (CAS 1170255-29-4) is a chemical compound with the molecular formula C11H15Cl2N3O and a molecular weight of 276.16 g/mol. IUPAC name: N-(3-chlorophenyl)piperazine-1-carboxamide;hydrochloride. InChIKey: JXILOJFETPZDMQ-UHFFFAOYSA-N.
| Molecular formula | C11H15Cl2N3O |
|---|---|
| Molecular weight | 276.16 g/mol |
| IUPAC name | N-(3-chlorophenyl)piperazine-1-carboxamide;hydrochloride |
| InChIKey | JXILOJFETPZDMQ-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C(=O)NC2=CC(=CC=C2)Cl.Cl |
Computed by PubChem (NCBI)