CAS 2126178-11-6 is the registry number for 5-(Aminomethyl)-1-methyl-2-phenyl-2,3-dihydro-1H-pyrazol-3-one dihydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
5-(aminomethyl)-1-methyl-2-phenylpyrazol-3-one;dihydrochloride (CAS 2126178-11-6) is a chemical compound with the molecular formula C11H15Cl2N3O and a molecular weight of 276.16 g/mol. IUPAC name: 5-(aminomethyl)-1-methyl-2-phenylpyrazol-3-one;dihydrochloride. InChIKey: MKLFAYLPGOKBKO-UHFFFAOYSA-N.
| Molecular formula | C11H15Cl2N3O |
|---|---|
| Molecular weight | 276.16 g/mol |
| IUPAC name | 5-(aminomethyl)-1-methyl-2-phenylpyrazol-3-one;dihydrochloride |
| InChIKey | MKLFAYLPGOKBKO-UHFFFAOYSA-N |
| SMILES | CN1C(=CC(=O)N1C2=CC=CC=C2)CN.Cl.Cl |
Computed by PubChem (NCBI)