2-Chlorobenzoyl cyanide, 95%
cas: 35022-42-5 — see every product listed under this CAS number, including other names
2-Chlorobenzoyl cyanide, 95% (CAS 35022-42-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A606235-250mg |
| cas | 35022-42-5 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 209.06 Pln | |
| Ambeed | 1g | 309.19 Pln | |
| Chemat | 250mg | 203.60 Pln | |
| Chemat | 1g | 467.60 Pln | |
| Chemat | 5g | 1773.20 Pln | |
| BLDpharm | 1g | 1164.06 Pln | |
| BLDpharm | 5g | 2619.10 Pln | |
| Fluorochem | 1g | 851.80 Pln | |
| Fluorochem | 5g | 3272.82 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
2-chlorobenzoyl cyanide (CAS 35022-42-5) is a chemical compound with the molecular formula C8H4ClNO and a molecular weight of 165.57 g/mol. IUPAC name: 2-chlorobenzoyl cyanide. InChIKey: YUCRNASRVPZKNQ-UHFFFAOYSA-N.
| Molecular formula | C8H4ClNO |
|---|---|
| Molecular weight | 165.57 g/mol |
| IUPAC name | 2-chlorobenzoyl cyanide |
| InChIKey | YUCRNASRVPZKNQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)C#N)Cl |
Computed by PubChem (NCBI)