2-Chloroquinolin-4(1H)-one, 95%
cas: 248607-95-6 — see every product listed under this CAS number, including other names
2-Chloroquinolin-4(1H)-one, 95% (CAS 248607-95-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A857590-250mg |
| cas | 248607-95-6 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 426.00 Pln | |
| Ambeed | 1g | 1021.19 Pln | |
| Ambeed | 5g | 4069.44 Pln | |
| Chemat | 100mg | 270.80 Pln | |
| Chemat | 250mg | 419.60 Pln | |
| Chemat | 1g | 1019.60 Pln | |
| Chemat | 5g | 4091.60 Pln | |
| BLDpharm | 100mg | 292.14 Pln | |
| BLDpharm | 250mg | 453.20 Pln | |
| BLDpharm | 1g | 1097.42 Pln | |
| BLDpharm | 5g | 4385.15 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
2-chloro-1H-quinolin-4-one (CAS 248607-95-6) is a chemical compound with the molecular formula C9H6ClNO and a molecular weight of 179.60 g/mol. IUPAC name: 2-chloro-1H-quinolin-4-one. InChIKey: ZGFLMSYIISDCLO-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO |
|---|---|
| Molecular weight | 179.60 g/mol |
| IUPAC name | 2-chloro-1H-quinolin-4-one |
| InChIKey | ZGFLMSYIISDCLO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C=C(N2)Cl |
Computed by PubChem (NCBI)