CAS 39545-31-8 appears in our catalog under these names: 2–Chlorobenzyl carbonochloridate, 2-CHLOROBENZYL CHLOROFORMATE, 95%. Offered by: GLPBio, Fluorochem. Available pack sizes: 100mg, 1g, 5g.
(2-chlorophenyl)methyl carbonochloridate (CAS 39545-31-8) is a chemical compound with the molecular formula C8H6Cl2O2 and a molecular weight of 205.03 g/mol. IUPAC name: (2-chlorophenyl)methyl carbonochloridate. InChIKey: GCCKNHYFOVQZRG-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2O2 |
|---|---|
| Molecular weight | 205.03 g/mol |
| IUPAC name | (2-chlorophenyl)methyl carbonochloridate |
| InChIKey | GCCKNHYFOVQZRG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)COC(=O)Cl)Cl |
Computed by PubChem (NCBI)