cas: 1025708-31-9 — see every product listed under this CAS number, including other names
2-Cyanopyrimidine-5-boronic acid pinacol ester 95% (CAS 1025708-31-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A618516-250mg |
| cas | 1025708-31-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 203.50 Pln | |
| Ambeed | 1g | 225.75 Pln | |
| Ambeed | 5g | 670.75 Pln | |
| Ambeed | 25g | 2222.69 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A618516 |
5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine-2-carbonitrile (CAS 1025708-31-9) is a chemical compound with the molecular formula C11H14BN3O2 and a molecular weight of 231.06 g/mol. IUPAC name: 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine-2-carbonitrile. InChIKey: KJQVHJSIJTVCMN-UHFFFAOYSA-N.
| Molecular formula | C11H14BN3O2 |
|---|---|
| Molecular weight | 231.06 g/mol |
| IUPAC name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine-2-carbonitrile |
| InChIKey | KJQVHJSIJTVCMN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(N=C2)C#N |
Computed by PubChem (NCBI)