cas: 1025708-31-9 — see every product listed under this CAS number, including other names
5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine-2-carbonitrile, 95%, 95% (CAS 1025708-31-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1118RE-100mg |
| cas | 1025708-31-9 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 107.60 Pln | |
| Chemat | 500mg | 117.20 Pln | |
| Chemat | 1g | 150.80 Pln | |
| Chemat | 5g | 491.60 Pln | |
| Chemat | 10g | 808.40 Pln | |
| Chemat | 25g | 1576.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine-2-carbonitrile (CAS 1025708-31-9) is a chemical compound with the molecular formula C11H14BN3O2 and a molecular weight of 231.06 g/mol. IUPAC name: 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine-2-carbonitrile. InChIKey: KJQVHJSIJTVCMN-UHFFFAOYSA-N.
| Molecular formula | C11H14BN3O2 |
|---|---|
| Molecular weight | 231.06 g/mol |
| IUPAC name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine-2-carbonitrile |
| InChIKey | KJQVHJSIJTVCMN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(N=C2)C#N |
Computed by PubChem (NCBI)