cas: 87100-15-0 — see every product listed under this CAS number, including other names
2-Cyclohexyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane 98% (CAS 87100-15-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A237614-1g |
| cas | 87100-15-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 192.38 Pln | |
| Ambeed | 10g | 203.50 Pln | |
| Ambeed | 25g | 286.94 Pln | |
| Ambeed | 100g | 871.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A237614 |
2-cyclohexyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 87100-15-0) is a chemical compound with the molecular formula C12H23BO2 and a molecular weight of 210.12 g/mol. IUPAC name: 2-cyclohexyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: OUEVCDGYTKLNMJ-UHFFFAOYSA-N.
| Molecular formula | C12H23BO2 |
|---|---|
| Molecular weight | 210.12 g/mol |
| IUPAC name | 2-cyclohexyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | OUEVCDGYTKLNMJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2CCCCC2 |
Computed by PubChem (NCBI)