cas: 87100-15-0 — see every product listed under this CAS number, including other names
2-Cyclohexyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%, 98% (CAS 87100-15-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114P6I-1g |
| cas | 87100-15-0 |
| size | 1g |
| availability | 125g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 102.80 Pln | |
| Chemat | 10g | 131.60 Pln | |
| Chemat | 25g | 232.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-cyclohexyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 87100-15-0) is a chemical compound with the molecular formula C12H23BO2 and a molecular weight of 210.12 g/mol. IUPAC name: 2-cyclohexyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: OUEVCDGYTKLNMJ-UHFFFAOYSA-N.
| Molecular formula | C12H23BO2 |
|---|---|
| Molecular weight | 210.12 g/mol |
| IUPAC name | 2-cyclohexyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | OUEVCDGYTKLNMJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2CCCCC2 |
Computed by PubChem (NCBI)